C13H17NOS2 — CID 107035978
(2,3-dimethylthiomorpholin-4-yl)-(4-sulfanylphenyl)methanone (PubChem CID 107035978) has the molecular formula C13H17NOS2 and a molecular weight of 267.42 g/mol. Its IUPAC name is (2,3-dimethylthiomorpholin-4-yl)-(4-sulfanylphenyl)methanone.
| Compound Name | (2,3-dimethylthiomorpholin-4-yl)-(4-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107035978 |
| Molecular Formula | C13H17NOS2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2,3-dimethylthiomorpholin-4-yl)-(4-sulfanylphenyl)methanone |
| SMILES | CC1SCCN(C(=O)c2ccc(S)cc2)C1C |
| InChI | InChI=1S/C13H17NOS2/c1-9-10(2)17-8-7-14(9)13(15)11-3-5-12(16)6-4-11/h3-6,9-10,16H,7-8H2,1-2H3 |
| InChIKey | IHHFDLKBEVAVHD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|