C11H12BrNOS — CID 122331900
(4-bromophenyl)-(2-methyl-1,3-thiazolidin-3-yl)methanone (PubChem CID 122331900) has the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. Its IUPAC name is (4-bromophenyl)-(2-methyl-1,3-thiazolidin-3-yl)methanone.
| Compound Name | (4-bromophenyl)-(2-methyl-1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 122331900 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | (4-bromophenyl)-(2-methyl-1,3-thiazolidin-3-yl)methanone |
| SMILES | CC1SCCN1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNOS/c1-8-13(6-7-15-8)11(14)9-2-4-10(12)5-3-9/h2-5,8H,6-7H2,1H3 |
| InChIKey | AMPSNTUHFLJCLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |