C17H17NO2S — CID 122331716
(2-methyl-1,3-thiazolidin-3-yl)-(4-phenoxyphenyl)methanone (PubChem CID 122331716) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is (2-methyl-1,3-thiazolidin-3-yl)-(4-phenoxyphenyl)methanone.
| Compound Name | (2-methyl-1,3-thiazolidin-3-yl)-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 122331716 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2-methyl-1,3-thiazolidin-3-yl)-(4-phenoxyphenyl)methanone |
| SMILES | CC1SCCN1C(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NO2S/c1-13-18(11-12-21-13)17(19)14-7-9-16(10-8-14)20-15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3 |
| InChIKey | DGIJGFJOAOKJOQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |