C19H23ClN2O2 — CID 120571312
(2,3-dimethylpiperazin-1-yl)-(4-phenoxyphenyl)methanone;hydrochloride (PubChem CID 120571312) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is (2,3-dimethylpiperazin-1-yl)-(4-phenoxyphenyl)methanone;hydrochloride.
| Compound Name | (2,3-dimethylpiperazin-1-yl)-(4-phenoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120571312 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2,3-dimethylpiperazin-1-yl)-(4-phenoxyphenyl)methanone;hydrochloride |
| SMILES | CC1NCCN(C(=O)c2ccc(Oc3ccccc3)cc2)C1C.Cl |
| InChI | InChI=1S/C19H22N2O2.ClH/c1-14-15(2)21(13-12-20-14)19(22)16-8-10-18(11-9-16)23-17-6-4-3-5-7-17;/h3-11,14-15,20H,12-13H2,1-2H3;1H |
| InChIKey | PYSJLTVJOMXJNM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |