About [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone
[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone (PubChem CID 129480648) has the molecular formula C16H23NO4S
and a molecular weight of 325.43 g/mol. Its IUPAC name is [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone.
Molecular Properties
| Compound Name | [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone |
| PubChem CID | 129480648 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone |
| SMILES | COc1ccc(C(=O)N2CCS[C@@H](C)[C@@H]2C)cc1OCCO |
| InChI | InChI=1S/C16H23NO4S/c1-11-12(2)22-9-6-17(11)16(19)13-4-5-14(20-3)15(10-13)21-8-7-18/h4-5,10-12,18H,6-9H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | WONNGPZNYNZZLV-RYUDHWBXSA-N |
| XLogP | 2.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone?
The IUPAC name of [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone (CID 129480648) is [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone.
What is the SMILES notation for [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone?
The canonical SMILES for [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone is COc1ccc(C(=O)N2CCS[C@@H](C)[C@@H]2C)cc1OCCO.
What is the InChIKey of [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone?
The InChIKey is WONNGPZNYNZZLV-RYUDHWBXSA-N. The full InChI is InChI=1S/C16H23NO4S/c1-11-12(2)22-9-6-17(11)16(19)13-4-5-14(20-3)15(10-13)21-8-7-18/h4-5,10-12,18H,6-9H2,1-3H3/t11-,12-/m0/s1.
What are the key properties of [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone?
[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone has a molecular weight of 325.43 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2,3-dimethylthiomorpholin-4-yl]-[3-(2-hydroxyethoxy)-4-methoxyphenyl]methanone is sourced from PubChem (CID 129480648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).