C23H29NO4S — CID 122345724
[2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-pentoxyphenyl)methanone (PubChem CID 122345724) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-pentoxyphenyl)methanone.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-pentoxyphenyl)methanone |
|---|---|
| PubChem CID | 122345724 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-pentoxyphenyl)methanone |
| SMILES | CCCCCOc1ccc(C(=O)N2CCSC2c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H29NO4S/c1-4-5-6-14-28-19-10-7-17(8-11-19)22(25)24-13-15-29-23(24)18-9-12-20(26-2)21(16-18)27-3/h7-12,16,23H,4-6,13-15H2,1-3H3 |
| InChIKey | RHLOZSVDRVMLPY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|