C24H21NO4S — CID 10409832
[4-(3-benzoyl-1,3-thiazolidin-2-yl)-2-methoxyphenyl] benzoate (PubChem CID 10409832) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is [4-(3-benzoyl-1,3-thiazolidin-2-yl)-2-methoxyphenyl] benzoate.
| Compound Name | [4-(3-benzoyl-1,3-thiazolidin-2-yl)-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 10409832 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [4-(3-benzoyl-1,3-thiazolidin-2-yl)-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(C2SCCN2C(=O)c2ccccc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21NO4S/c1-28-21-16-19(12-13-20(21)29-24(27)18-10-6-3-7-11-18)23-25(14-15-30-23)22(26)17-8-4-2-5-9-17/h2-13,16,23H,14-15H2,1H3 |
| InChIKey | XIBYONLQKXYWKS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|