C18H18INO3S — CID 122345806
[2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(3-iodophenyl)methanone (PubChem CID 122345806) has the molecular formula C18H18INO3S and a molecular weight of 455.32 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(3-iodophenyl)methanone.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 122345806 |
| Molecular Formula | C18H18INO3S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(3-iodophenyl)methanone |
| SMILES | COc1ccc(C2SCCN2C(=O)c2cccc(I)c2)cc1OC |
| InChI | InChI=1S/C18H18INO3S/c1-22-15-7-6-13(11-16(15)23-2)18-20(8-9-24-18)17(21)12-4-3-5-14(19)10-12/h3-7,10-11,18H,8-9H2,1-2H3 |
| InChIKey | DUVIUEJJWBYAIE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|