C20H23NOS — CID 4058369
[2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]-phenylmethanone (PubChem CID 4058369) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]-phenylmethanone.
| Compound Name | [2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 4058369 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]-phenylmethanone |
| SMILES | CC(C)(C)c1ccc(C2SCCN2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NOS/c1-20(2,3)17-11-9-16(10-12-17)19-21(13-14-23-19)18(22)15-7-5-4-6-8-15/h4-12,19H,13-14H2,1-3H3 |
| InChIKey | ZRSISCXVXWESPK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |