C15H21NOS — CID 4076126
1-[2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 4076126) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 1-[2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 4076126 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC(=O)N1CCSC1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21NOS/c1-11(17)16-9-10-18-14(16)12-5-7-13(8-6-12)15(2,3)4/h5-8,14H,9-10H2,1-4H3 |
| InChIKey | UWGNDYDFECDVJT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |