C15H17ClF3NOS — CID 5060370
3-chloro-2,2-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-3-yl]propan-1-one (PubChem CID 5060370) has the molecular formula C15H17ClF3NOS and a molecular weight of 351.82 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-3-yl]propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 5060370 |
| Molecular Formula | C15H17ClF3NOS |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-3-yl]propan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCSC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17ClF3NOS/c1-14(2,9-16)13(21)20-7-8-22-12(20)10-3-5-11(6-4-10)15(17,18)19/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | WDKSJPGRDIIIJI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|