C18H27NOS — CID 7415161
1-[(2R)-2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]pentan-1-one (PubChem CID 7415161) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is 1-[(2R)-2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]pentan-1-one.
| Compound Name | 1-[(2R)-2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 7415161 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-[(2R)-2-(4-tert-butylphenyl)-1,3-thiazolidin-3-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCS[C@@H]1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NOS/c1-5-6-7-16(20)19-12-13-21-17(19)14-8-10-15(11-9-14)18(2,3)4/h8-11,17H,5-7,12-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | RLQWLVFKFCPFLE-QGZVFWFLSA-N |
| XLogP | 4.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |