C18H26FNOS — CID 5237084
1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]nonan-1-one (PubChem CID 5237084) has the molecular formula C18H26FNOS and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]nonan-1-one.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]nonan-1-one |
|---|---|
| PubChem CID | 5237084 |
| Molecular Formula | C18H26FNOS |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FNOS/c1-2-3-4-5-6-7-8-17(21)20-13-14-22-18(20)15-9-11-16(19)12-10-15/h9-12,18H,2-8,13-14H2,1H3 |
| InChIKey | WAEBNLBZKDOPMW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|