C17H23NO3S — CID 7301739
1-[(2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-3-yl]heptan-1-one (PubChem CID 7301739) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[(2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-3-yl]heptan-1-one.
| Compound Name | 1-[(2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-3-yl]heptan-1-one |
|---|---|
| PubChem CID | 7301739 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[(2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-3-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCS[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H23NO3S/c1-2-3-4-5-6-16(19)18-9-10-22-17(18)13-7-8-14-15(11-13)21-12-20-14/h7-8,11,17H,2-6,9-10,12H2,1H3/t17-/m1/s1 |
| InChIKey | XPXFEJLVLWRPFF-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|