C23H27NO3S — CID 4206772
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazolidin-3-yl]-(4-pentylphenyl)methanone (PubChem CID 4206772) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazolidin-3-yl]-(4-pentylphenyl)methanone.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazolidin-3-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 4206772 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazolidin-3-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCSC2c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-2-3-4-5-17-6-8-18(9-7-17)22(25)24-12-15-28-23(24)19-10-11-20-21(16-19)27-14-13-26-20/h6-11,16,23H,2-5,12-15H2,1H3 |
| InChIKey | XSBKOUFVPQKEJR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|