C19H23NOS2 — CID 7360731
(4-pentylphenyl)-[(2R)-2-thiophen-2-yl-1,3-thiazolidin-3-yl]methanone (PubChem CID 7360731) has the molecular formula C19H23NOS2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (4-pentylphenyl)-[(2R)-2-thiophen-2-yl-1,3-thiazolidin-3-yl]methanone.
| Compound Name | (4-pentylphenyl)-[(2R)-2-thiophen-2-yl-1,3-thiazolidin-3-yl]methanone |
|---|---|
| PubChem CID | 7360731 |
| Molecular Formula | C19H23NOS2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (4-pentylphenyl)-[(2R)-2-thiophen-2-yl-1,3-thiazolidin-3-yl]methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCS[C@@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C19H23NOS2/c1-2-3-4-6-15-8-10-16(11-9-15)18(21)20-12-14-23-19(20)17-7-5-13-22-17/h5,7-11,13,19H,2-4,6,12,14H2,1H3/t19-/m1/s1 |
| InChIKey | QWAXUOWGLIQONS-LJQANCHMSA-N |
| XLogP | 5.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|