C24H31NO3S — CID 4160929
[2-(2,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone (PubChem CID 4160929) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone.
| Compound Name | [2-(2,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 4160929 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCSC2c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H31NO3S/c1-4-5-6-7-8-18-9-11-19(12-10-18)23(26)25-15-16-29-24(25)21-14-13-20(27-2)17-22(21)28-3/h9-14,17,24H,4-8,15-16H2,1-3H3 |
| InChIKey | OQAJUVGDFSVXNL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|