C22H26FNOS — CID 7350573
[(2R)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone (PubChem CID 7350573) has the molecular formula C22H26FNOS and a molecular weight of 371.52 g/mol. Its IUPAC name is [(2R)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone.
| Compound Name | [(2R)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 7350573 |
| Molecular Formula | C22H26FNOS |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(2R)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCS[C@@H]2c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H26FNOS/c1-2-3-4-5-8-17-11-13-18(14-12-17)21(25)24-15-16-26-22(24)19-9-6-7-10-20(19)23/h6-7,9-14,22H,2-5,8,15-16H2,1H3/t22-/m1/s1 |
| InChIKey | YONLLFARDSLZDQ-JOCHJYFZSA-N |
| XLogP | 5.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|