C23H29NO5S — CID 122330603
(4-butoxyphenyl)-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone (PubChem CID 122330603) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is (4-butoxyphenyl)-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone |
|---|---|
| PubChem CID | 122330603 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (4-butoxyphenyl)-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCSC2c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C23H29NO5S/c1-5-6-12-29-17-9-7-16(8-10-17)22(25)24-11-13-30-23(24)18-14-20(27-3)21(28-4)15-19(18)26-2/h7-10,14-15,23H,5-6,11-13H2,1-4H3 |
| InChIKey | QYBWSVKUNPHTNP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|