C20H20N2O4S — CID 122330771
3-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]benzonitrile (PubChem CID 122330771) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]benzonitrile.
| Compound Name | 3-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 122330771 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]benzonitrile |
| SMILES | COc1cc(OC)c(C2SCCN2C(=O)c2cccc(C#N)c2)cc1OC |
| InChI | InChI=1S/C20H20N2O4S/c1-24-16-11-18(26-3)17(25-2)10-15(16)20-22(7-8-27-20)19(23)14-6-4-5-13(9-14)12-21/h4-6,9-11,20H,7-8H2,1-3H3 |
| InChIKey | VYVZPDGOAQKSTR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |