C15H15NO2S2 — CID 42781009
2-phenoxy-1-(2-thiophen-2-yl-1,3-thiazolidin-3-yl)ethanone (PubChem CID 42781009) has the molecular formula C15H15NO2S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-phenoxy-1-(2-thiophen-2-yl-1,3-thiazolidin-3-yl)ethanone.
| Compound Name | 2-phenoxy-1-(2-thiophen-2-yl-1,3-thiazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 42781009 |
| Molecular Formula | C15H15NO2S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-phenoxy-1-(2-thiophen-2-yl-1,3-thiazolidin-3-yl)ethanone |
| SMILES | O=C(COc1ccccc1)N1CCSC1c1cccs1 |
| InChI | InChI=1S/C15H15NO2S2/c17-14(11-18-12-5-2-1-3-6-12)16-8-10-20-15(16)13-7-4-9-19-13/h1-7,9,15H,8,10-11H2 |
| InChIKey | HBJNXUSVMIFZQQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |