C17H15Cl2NO2S — CID 5077564
1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone (PubChem CID 5077564) has the molecular formula C17H15Cl2NO2S and a molecular weight of 368.29 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 5077564 |
| Molecular Formula | C17H15Cl2NO2S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCSC1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H15Cl2NO2S/c18-14-8-4-7-13(16(14)19)17-20(9-10-23-17)15(21)11-22-12-5-2-1-3-6-12/h1-8,17H,9-11H2 |
| InChIKey | CLZDNHGYFHPSKW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |