C15H19Cl2NOS — CID 5086784
1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]hexan-1-one (PubChem CID 5086784) has the molecular formula C15H19Cl2NOS and a molecular weight of 332.30 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]hexan-1-one.
| Compound Name | 1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]hexan-1-one |
|---|---|
| PubChem CID | 5086784 |
| Molecular Formula | C15H19Cl2NOS |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 1-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-3-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCSC1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H19Cl2NOS/c1-2-3-4-8-13(19)18-9-10-20-15(18)11-6-5-7-12(16)14(11)17/h5-7,15H,2-4,8-10H2,1H3 |
| InChIKey | RXNYJWVTWVVGPA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|