C16H23NO3S — CID 3320188
1-[2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-3-yl]pentan-1-one (PubChem CID 3320188) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-3-yl]pentan-1-one.
| Compound Name | 1-[2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 3320188 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-3-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCSC1c1cccc(OC)c1OC |
| InChI | InChI=1S/C16H23NO3S/c1-4-5-9-14(18)17-10-11-21-16(17)12-7-6-8-13(19-2)15(12)20-3/h6-8,16H,4-5,9-11H2,1-3H3 |
| InChIKey | MJPDGWDGSCGUFX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |