C22H27NO2S — CID 7271195
1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]hexan-1-one (PubChem CID 7271195) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]hexan-1-one.
| Compound Name | 1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]hexan-1-one |
|---|---|
| PubChem CID | 7271195 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCS[C@H]1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO2S/c1-2-3-5-14-21(24)23-15-16-26-22(23)19-12-8-9-13-20(19)25-17-18-10-6-4-7-11-18/h4,6-13,22H,2-3,5,14-17H2,1H3/t22-/m0/s1 |
| InChIKey | OEYYRRINEIOFAR-QFIPXVFZSA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|