C19H20ClNO2S — CID 1025017
(2R)-2-chloro-1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]propan-1-one (PubChem CID 1025017) has the molecular formula C19H20ClNO2S and a molecular weight of 361.89 g/mol. Its IUPAC name is (2R)-2-chloro-1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]propan-1-one.
| Compound Name | (2R)-2-chloro-1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 1025017 |
| Molecular Formula | C19H20ClNO2S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2R)-2-chloro-1-[(2S)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]propan-1-one |
| SMILES | C[C@@H](Cl)C(=O)N1CCS[C@H]1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H20ClNO2S/c1-14(20)18(22)21-11-12-24-19(21)16-9-5-6-10-17(16)23-13-15-7-3-2-4-8-15/h2-10,14,19H,11-13H2,1H3/t14-,19+/m1/s1 |
| InChIKey | XHBATNWPFONWGW-KUHUBIRLSA-N |
| XLogP | 4.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|