C17H16Cl2N2OS — CID 5211610
N-benzyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 5211610) has the molecular formula C17H16Cl2N2OS and a molecular weight of 367.30 g/mol. Its IUPAC name is N-benzyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-benzyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 5211610 |
| Molecular Formula | C17H16Cl2N2OS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-benzyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCSC1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2OS/c18-14-8-4-7-13(15(14)19)16-21(9-10-23-16)17(22)20-11-12-5-2-1-3-6-12/h1-8,16H,9-11H2,(H,20,22) |
| InChIKey | XJEMBLJUOUIZNW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |