C19H21ClN2OS — CID 90629887
N-benzyl-7-(2-chlorophenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90629887) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is N-benzyl-7-(2-chlorophenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-benzyl-7-(2-chlorophenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90629887 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-benzyl-7-(2-chlorophenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H21ClN2OS/c20-17-9-5-4-8-16(17)18-10-11-22(12-13-24-18)19(23)21-14-15-6-2-1-3-7-15/h1-9,18H,10-14H2,(H,21,23) |
| InChIKey | SFJOAVFPLVDPNG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |