C18H17BrClNOS — CID 121163532
(4-bromophenyl)-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]methanone (PubChem CID 121163532) has the molecular formula C18H17BrClNOS and a molecular weight of 410.76 g/mol. Its IUPAC name is (4-bromophenyl)-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]methanone.
| Compound Name | (4-bromophenyl)-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 121163532 |
| Molecular Formula | C18H17BrClNOS |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | (4-bromophenyl)-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C(c1ccc(Br)cc1)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H17BrClNOS/c19-14-7-5-13(6-8-14)18(22)21-10-9-17(23-12-11-21)15-3-1-2-4-16(15)20/h1-8,17H,9-12H2 |
| InChIKey | VOLFGWIBKSOKRJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |