C20H22ClNO3S — CID 90629736
[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3,5-dimethoxyphenyl)methanone (PubChem CID 90629736) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3,5-dimethoxyphenyl)methanone.
| Compound Name | [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90629736 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCSC(c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-24-15-11-14(12-16(13-15)25-2)20(23)22-8-7-19(26-10-9-22)17-5-3-4-6-18(17)21/h3-6,11-13,19H,7-10H2,1-2H3 |
| InChIKey | NOUIJPAXQOWBPM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |