C18H17ClN2O3S — CID 90629745
[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone (PubChem CID 90629745) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90629745 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H17ClN2O3S/c19-16-7-2-1-6-15(16)17-8-9-20(10-11-25-17)18(22)13-4-3-5-14(12-13)21(23)24/h1-7,12,17H,8-11H2 |
| InChIKey | QYNRQLCALNVXCP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|