C16H16N2O4S — CID 90632150
[7-(furan-2-yl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone (PubChem CID 90632150) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is [7-(furan-2-yl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [7-(furan-2-yl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90632150 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [7-(furan-2-yl)-1,4-thiazepan-4-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C16H16N2O4S/c19-16(12-3-1-4-13(11-12)18(20)21)17-7-6-15(23-10-8-17)14-5-2-9-22-14/h1-5,9,11,15H,6-8,10H2 |
| InChIKey | HVBPDFOSUOEXHZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|