C13H17N3O3S — CID 90632446
1-[7-(furan-2-yl)-1,4-thiazepane-4-carbonyl]imidazolidin-2-one (PubChem CID 90632446) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-[7-(furan-2-yl)-1,4-thiazepane-4-carbonyl]imidazolidin-2-one.
| Compound Name | 1-[7-(furan-2-yl)-1,4-thiazepane-4-carbonyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 90632446 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[7-(furan-2-yl)-1,4-thiazepane-4-carbonyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1C(=O)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C13H17N3O3S/c17-12-14-4-6-16(12)13(18)15-5-3-11(20-9-7-15)10-2-1-8-19-10/h1-2,8,11H,3-7,9H2,(H,14,17) |
| InChIKey | BEJCQRGZNLBVHD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |