C13H20N2O2S — CID 90632439
7-(furan-2-yl)-N-propyl-1,4-thiazepane-4-carboxamide (PubChem CID 90632439) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 7-(furan-2-yl)-N-propyl-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(furan-2-yl)-N-propyl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90632439 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-(furan-2-yl)-N-propyl-1,4-thiazepane-4-carboxamide |
| SMILES | CCCNC(=O)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C13H20N2O2S/c1-2-6-14-13(16)15-7-5-12(18-10-8-15)11-4-3-9-17-11/h3-4,9,12H,2,5-8,10H2,1H3,(H,14,16) |
| InChIKey | WEANGTRHMBPATP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |