C18H22N2O4S — CID 90632425
N-(3,5-dimethoxyphenyl)-7-(furan-2-yl)-1,4-thiazepane-4-carboxamide (PubChem CID 90632425) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-7-(furan-2-yl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-7-(furan-2-yl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90632425 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-7-(furan-2-yl)-1,4-thiazepane-4-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCSC(c3ccco3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-22-14-10-13(11-15(12-14)23-2)19-18(21)20-6-5-17(25-9-7-20)16-4-3-8-24-16/h3-4,8,10-12,17H,5-7,9H2,1-2H3,(H,19,21) |
| InChIKey | JOCXKWCNWBJDIB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |