C16H15Cl2NO2S — CID 72720400
(2,5-dichlorophenyl)-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone (PubChem CID 72720400) has the molecular formula C16H15Cl2NO2S and a molecular weight of 356.27 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone.
| Compound Name | (2,5-dichlorophenyl)-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 72720400 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (2,5-dichlorophenyl)-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C16H15Cl2NO2S/c17-11-3-4-13(18)12(10-11)16(20)19-6-5-15(22-9-7-19)14-2-1-8-21-14/h1-4,8,10,15H,5-7,9H2 |
| InChIKey | RFSZRWOJHNEQCO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |