C18H18N2O2S — CID 90632059
[7-(furan-2-yl)-1,4-thiazepan-4-yl]-(1H-indol-2-yl)methanone (PubChem CID 90632059) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is [7-(furan-2-yl)-1,4-thiazepan-4-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [7-(furan-2-yl)-1,4-thiazepan-4-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 90632059 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [7-(furan-2-yl)-1,4-thiazepan-4-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C18H18N2O2S/c21-18(15-12-13-4-1-2-5-14(13)19-15)20-8-7-17(23-11-9-20)16-6-3-10-22-16/h1-6,10,12,17,19H,7-9,11H2 |
| InChIKey | DAGVHXBMWXTDFG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |