C17H17N3O2S — CID 90632074
3H-benzimidazol-5-yl-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone (PubChem CID 90632074) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 90632074 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3H-benzimidazol-5-yl-[7-(furan-2-yl)-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C17H17N3O2S/c21-17(12-3-4-13-14(10-12)19-11-18-13)20-6-5-16(23-9-7-20)15-2-1-8-22-15/h1-4,8,10-11,16H,5-7,9H2,(H,18,19) |
| InChIKey | FDASCDBRDRGHTR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |