C18H17N3O2S — CID 90632231
[7-(furan-2-yl)-1,4-thiazepan-4-yl]-quinoxalin-2-ylmethanone (PubChem CID 90632231) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is [7-(furan-2-yl)-1,4-thiazepan-4-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [7-(furan-2-yl)-1,4-thiazepan-4-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 90632231 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [7-(furan-2-yl)-1,4-thiazepan-4-yl]-quinoxalin-2-ylmethanone |
| SMILES | O=C(c1cnc2ccccc2n1)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C18H17N3O2S/c22-18(15-12-19-13-4-1-2-5-14(13)20-15)21-8-7-17(24-11-9-21)16-6-3-10-23-16/h1-6,10,12,17H,7-9,11H2 |
| InChIKey | YLKDVTXJHIPLCD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |