C18H18ClNO2S — CID 90632321
(E)-3-(4-chlorophenyl)-1-[7-(furan-2-yl)-1,4-thiazepan-4-yl]prop-2-en-1-one (PubChem CID 90632321) has the molecular formula C18H18ClNO2S and a molecular weight of 347.87 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[7-(furan-2-yl)-1,4-thiazepan-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[7-(furan-2-yl)-1,4-thiazepan-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90632321 |
| Molecular Formula | C18H18ClNO2S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[7-(furan-2-yl)-1,4-thiazepan-4-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C18H18ClNO2S/c19-15-6-3-14(4-7-15)5-8-18(21)20-10-9-17(23-13-11-20)16-2-1-12-22-16/h1-8,12,17H,9-11,13H2/b8-5+ |
| InChIKey | QIIWCFSBUQVHEM-VMPITWQZSA-N |
| XLogP | 4.65 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|