C18H15ClF3NOS — CID 99878673
[(7R)-7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 99878673) has the molecular formula C18H15ClF3NOS and a molecular weight of 385.84 g/mol. Its IUPAC name is [(7R)-7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [(7R)-7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 99878673 |
| Molecular Formula | C18H15ClF3NOS |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [(7R)-7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCS[C@@H](c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H15ClF3NOS/c19-13-4-2-1-3-11(13)15-7-8-23(9-10-25-15)18(24)12-5-6-14(20)17(22)16(12)21/h1-6,15H,7-10H2/t15-/m1/s1 |
| InChIKey | JQBQXNBPIHOCBK-OAHLLOKOSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|