C21H19ClN2OS — CID 90629831
[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-isoquinolin-1-ylmethanone (PubChem CID 90629831) has the molecular formula C21H19ClN2OS and a molecular weight of 382.92 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 90629831 |
| Molecular Formula | C21H19ClN2OS |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1nccc2ccccc12)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H19ClN2OS/c22-18-8-4-3-7-17(18)19-10-12-24(13-14-26-19)21(25)20-16-6-2-1-5-15(16)9-11-23-20/h1-9,11,19H,10,12-14H2 |
| InChIKey | SNIKRONNBVKBCT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |