C21H18ClNO3S — CID 124670847
2-[(7R)-7-(2-chlorophenyl)-1,4-thiazepane-4-carbonyl]chromen-4-one (PubChem CID 124670847) has the molecular formula C21H18ClNO3S and a molecular weight of 399.90 g/mol. Its IUPAC name is 2-[(7R)-7-(2-chlorophenyl)-1,4-thiazepane-4-carbonyl]chromen-4-one.
| Compound Name | 2-[(7R)-7-(2-chlorophenyl)-1,4-thiazepane-4-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 124670847 |
| Molecular Formula | C21H18ClNO3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-[(7R)-7-(2-chlorophenyl)-1,4-thiazepane-4-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CCS[C@@H](c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H18ClNO3S/c22-16-7-3-1-5-14(16)20-9-10-23(11-12-27-20)21(25)19-13-17(24)15-6-2-4-8-18(15)26-19/h1-8,13,20H,9-12H2/t20-/m1/s1 |
| InChIKey | MRHWVFBDZLHFIN-HXUWFJFHSA-N |
| XLogP | 4.77 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |