C16H17NO4 — CID 115966240
2-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]chromen-4-one (PubChem CID 115966240) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]chromen-4-one.
| Compound Name | 2-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 115966240 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]chromen-4-one |
| SMILES | CC(O)C1CCN(C(=O)c2cc(=O)c3ccccc3o2)C1 |
| InChI | InChI=1S/C16H17NO4/c1-10(18)11-6-7-17(9-11)16(20)15-8-13(19)12-4-2-3-5-14(12)21-15/h2-5,8,10-11,18H,6-7,9H2,1H3 |
| InChIKey | JMGIZAPTPFNMCG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |