C17H19NO4 — CID 95582758
2-[(3R)-3-ethoxypiperidine-1-carbonyl]chromen-4-one (PubChem CID 95582758) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[(3R)-3-ethoxypiperidine-1-carbonyl]chromen-4-one.
| Compound Name | 2-[(3R)-3-ethoxypiperidine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 95582758 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(3R)-3-ethoxypiperidine-1-carbonyl]chromen-4-one |
| SMILES | CCO[C@@H]1CCCN(C(=O)c2cc(=O)c3ccccc3o2)C1 |
| InChI | InChI=1S/C17H19NO4/c1-2-21-12-6-5-9-18(11-12)17(20)16-10-14(19)13-7-3-4-8-15(13)22-16/h3-4,7-8,10,12H,2,5-6,9,11H2,1H3/t12-/m1/s1 |
| InChIKey | NURNBLIADLKVLF-GFCCVEGCSA-N |
| XLogP | 2.43 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |