C20H18N2O4 — CID 122255813
2-(3-pyridin-4-yloxypiperidine-1-carbonyl)chromen-4-one (PubChem CID 122255813) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-(3-pyridin-4-yloxypiperidine-1-carbonyl)chromen-4-one.
| Compound Name | 2-(3-pyridin-4-yloxypiperidine-1-carbonyl)chromen-4-one |
|---|---|
| PubChem CID | 122255813 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-(3-pyridin-4-yloxypiperidine-1-carbonyl)chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CCCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C20H18N2O4/c23-17-12-19(26-18-6-2-1-5-16(17)18)20(24)22-11-3-4-15(13-22)25-14-7-9-21-10-8-14/h1-2,5-10,12,15H,3-4,11,13H2 |
| InChIKey | FLLYLLYGBSTZAT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |