C20H16Cl2N2O5S — CID 27563251
2-[4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carbonyl]chromen-4-one (PubChem CID 27563251) has the molecular formula C20H16Cl2N2O5S and a molecular weight of 467.33 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carbonyl]chromen-4-one.
| Compound Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 27563251 |
| Molecular Formula | C20H16Cl2N2O5S |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C20H16Cl2N2O5S/c21-14-5-3-7-18(19(14)22)30(27,28)24-10-8-23(9-11-24)20(26)17-12-15(25)13-4-1-2-6-16(13)29-17/h1-7,12H,8-11H2 |
| InChIKey | OPZDALCTPGOZEH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |