C18H18Cl2N2OS — CID 90629872
7-(2-chlorophenyl)-N-(3-chlorophenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90629872) has the molecular formula C18H18Cl2N2OS and a molecular weight of 381.33 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-N-(3-chlorophenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(2-chlorophenyl)-N-(3-chlorophenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90629872 |
| Molecular Formula | C18H18Cl2N2OS |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 7-(2-chlorophenyl)-N-(3-chlorophenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H18Cl2N2OS/c19-13-4-3-5-14(12-13)21-18(23)22-9-8-17(24-11-10-22)15-6-1-2-7-16(15)20/h1-7,12,17H,8-11H2,(H,21,23) |
| InChIKey | SKNKZSVDHKKSRU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |