C18H25ClN2OS — CID 90629870
7-(2-chlorophenyl)-N-cyclohexyl-1,4-thiazepane-4-carboxamide (PubChem CID 90629870) has the molecular formula C18H25ClN2OS and a molecular weight of 352.93 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-N-cyclohexyl-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(2-chlorophenyl)-N-cyclohexyl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90629870 |
| Molecular Formula | C18H25ClN2OS |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 7-(2-chlorophenyl)-N-cyclohexyl-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN2OS/c19-16-9-5-4-8-15(16)17-10-11-21(12-13-23-17)18(22)20-14-6-2-1-3-7-14/h4-5,8-9,14,17H,1-3,6-7,10-13H2,(H,20,22) |
| InChIKey | IWLXNANLEOFNAN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |