C19H28ClNOS — CID 121163519
1-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-2-propylpentan-1-one (PubChem CID 121163519) has the molecular formula C19H28ClNOS and a molecular weight of 353.96 g/mol. Its IUPAC name is 1-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-2-propylpentan-1-one.
| Compound Name | 1-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-2-propylpentan-1-one |
|---|---|
| PubChem CID | 121163519 |
| Molecular Formula | C19H28ClNOS |
| Molecular Weight | 353.96 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]-2-propylpentan-1-one |
| SMILES | CCCC(CCC)C(=O)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClNOS/c1-3-7-15(8-4-2)19(22)21-12-11-18(23-14-13-21)16-9-5-6-10-17(16)20/h5-6,9-10,15,18H,3-4,7-8,11-14H2,1-2H3 |
| InChIKey | AQQTYBMCRLBVMV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.96 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |